Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 27655-40-9, Name is Isoquinoline-5-sulfonic acid, SMILES is O=S(C1=CC=CC2=C1C=CN=C2)(O)=O, belongs to isoquinoline compound. In a document, author is Liu Zhen-ming, introduce the new discover, Computed Properties of C9H7NO3S.
Efficient One-pot Synthesis of Pyrrolo[2,1-a]isoquinoline and Pyrrolo[1,2-a]quinoline Derivatives
A one-pot sequential reaction for efficient synthesis of pyrrolo[2,1-a]isoquinoline and pyrrolo[1,2-a]quinoline derivatives has been developed. The reaction included firstly the Cu-catalyzed three-component reaction of isoquinoline(quinoline), acetylenedicarboxylate and allcynylbenzene and then Cs2CO3-promoted intramolecular cyclization reaction of initially formed 1-alkenyl-2-alkynyl-1,2-dihydroisoquinoline(1,2-dihydroquinoline).
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 27655-40-9 is helpful to your research. Computed Properties of C9H7NO3S.
Reference:
Isoquinoline – Wikipedia,
,Isoquinoline | C9H7N – PubChem